churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

A balanced equation representing a chemical reaction can be written using (1) chemical formulas and mass numbers (2) chemical formulas and coefficients (3) firs

A balanced equation representing a chemical reaction can be written using (1) chemical formulas and mass numbers (2) chemical formulas and coefficients (3) firs

what is the name of the symbol that shows directions on a map

An explosion that destroys the outer portion of a star is known as a

How many cloud types there is?

As carbon dioxide sublimes, its entropy (1) decreases (2) increases (3) remains the same

Could someone explain to me the origins of the english language?

At the beginning of the Industrial Revolution, the old money/ aristocracy of Britain increased their wealth by investing in new factories and businesses T/F

what is an equivalent decimal to 9/15

At STP, which sample contains the same number of molecules as 11.2 liters of CO2(g) at STP? (1) 5.6 L of NO2(g) (3) 11.2 L of N2(g) (2) 7.5 L of H2(g) (4) 22.4